C16H21ClN4O4S — CID 24734321
2-[7-[(5-chlorothiophen-2-yl)methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 24734321) has the molecular formula C16H21ClN4O4S and a molecular weight of 400.89 g/mol. Its IUPAC name is 2-[7-[(5-chlorothiophen-2-yl)methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[7-[(5-chlorothiophen-2-yl)methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 24734321 |
| Molecular Formula | C16H21ClN4O4S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-[7-[(5-chlorothiophen-2-yl)methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)C2CN(Cc3ccc(Cl)s3)CCN2C1=O |
| InChI | InChI=1S/C16H21ClN4O4S/c1-25-7-4-18-14(22)10-21-15(23)12-9-19(5-6-20(12)16(21)24)8-11-2-3-13(17)26-11/h2-3,12H,4-10H2,1H3,(H,18,22) |
| InChIKey | RXSTTXDJFGSCIT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|