About 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine
5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 24734609) has the molecular formula C17H15F3N4S
and a molecular weight of 364.40 g/mol. Its IUPAC name is 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine.
Molecular Properties
| Compound Name | 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine |
| PubChem CID | 24734609 |
| Molecular Formula | C17H15F3N4S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | FC(F)(F)c1ccc2c(N3CCNCC3)ncc(-c3ccsc3)c2n1 |
| InChI | InChI=1S/C17H15F3N4S/c18-17(19,20)14-2-1-12-15(23-14)13(11-3-8-25-10-11)9-22-16(12)24-6-4-21-5-7-24/h1-3,8-10,21H,4-7H2 |
| InChIKey | HLEOOYPBDFQBGE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine?
The IUPAC name of 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine (CID 24734609) is 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine.
What is the SMILES notation for 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine?
The canonical SMILES for 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine is FC(F)(F)c1ccc2c(N3CCNCC3)ncc(-c3ccsc3)c2n1.
What is the InChIKey of 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine?
The InChIKey is HLEOOYPBDFQBGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4S/c18-17(19,20)14-2-1-12-15(23-14)13(11-3-8-25-10-11)9-22-16(12)24-6-4-21-5-7-24/h1-3,8-10,21H,4-7H2.
What are the key properties of 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine?
5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine has a molecular weight of 364.40 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperazin-1-yl-8-thiophen-3-yl-2-(trifluoromethyl)-1,6-naphthyridine is sourced from PubChem (CID 24734609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).