C23H20F3N5O2 — CID 24735130
2-(2-phenylethyl)-7-[2-(trifluoromethyl)-1,6-naphthyridin-5-yl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 24735130) has the molecular formula C23H20F3N5O2 and a molecular weight of 455.44 g/mol. Its IUPAC name is 2-(2-phenylethyl)-7-[2-(trifluoromethyl)-1,6-naphthyridin-5-yl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 2-(2-phenylethyl)-7-[2-(trifluoromethyl)-1,6-naphthyridin-5-yl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 24735130 |
| Molecular Formula | C23H20F3N5O2 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-(2-phenylethyl)-7-[2-(trifluoromethyl)-1,6-naphthyridin-5-yl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | O=C1C2CN(c3nccc4nc(C(F)(F)F)ccc34)CCN2C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C23H20F3N5O2/c24-23(25,26)19-7-6-16-17(28-19)8-10-27-20(16)29-12-13-30-18(14-29)21(32)31(22(30)33)11-9-15-4-2-1-3-5-15/h1-8,10,18H,9,11-14H2 |
| InChIKey | KCMNSAYMFIIADD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|