C19H19F2N3O — CID 24735754
3-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 24735754) has the molecular formula C19H19F2N3O and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 24735754 |
| Molecular Formula | C19H19F2N3O |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(Cc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H19F2N3O/c20-14-6-5-13(16(21)11-14)12-23-9-7-15(8-10-23)24-18-4-2-1-3-17(18)22-19(24)25/h1-6,11,15H,7-10,12H2,(H,22,25) |
| InChIKey | YBESBLQKGFXFIE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |