C24H26N2O3 — CID 24736139
cyclopropyl-[4-[[5-(2-methoxyphenyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]methanone (PubChem CID 24736139) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is cyclopropyl-[4-[[5-(2-methoxyphenyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[[5-(2-methoxyphenyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24736139 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | cyclopropyl-[4-[[5-(2-methoxyphenyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]methanone |
| SMILES | COc1ccccc1-c1ccc2oc(CN3CCN(C(=O)C4CC4)CC3)cc2c1 |
| InChI | InChI=1S/C24H26N2O3/c1-28-23-5-3-2-4-21(23)18-8-9-22-19(14-18)15-20(29-22)16-25-10-12-26(13-11-25)24(27)17-6-7-17/h2-5,8-9,14-15,17H,6-7,10-13,16H2,1H3 |
| InChIKey | GJCTXUWOZUYXPU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |