C20H20N4O3S — CID 24737656
[3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-ethylcarbamate (PubChem CID 24737656) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-ethylcarbamate.
| Compound Name | [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 24737656 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [3-cyano-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CCc2c(sc(NC(=O)/C=C/c3cccnc3)c2C#N)C1 |
| InChI | InChI=1S/C20H20N4O3S/c1-2-23-20(26)27-14-6-7-15-16(11-21)19(28-17(15)10-14)24-18(25)8-5-13-4-3-9-22-12-13/h3-5,8-9,12,14H,2,6-7,10H2,1H3,(H,23,26)(H,24,25)/b8-5+ |
| InChIKey | KIHFMDUCVBPJJO-VMPITWQZSA-N |
| XLogP | 3.27 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|