C18H25NO3S — CID 24737943
4-[2,8-di(propan-2-yl)-3-sulfanylidene-1,4-benzoxazin-4-yl]butanoic acid (PubChem CID 24737943) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-[2,8-di(propan-2-yl)-3-sulfanylidene-1,4-benzoxazin-4-yl]butanoic acid.
| Compound Name | 4-[2,8-di(propan-2-yl)-3-sulfanylidene-1,4-benzoxazin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 24737943 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-[2,8-di(propan-2-yl)-3-sulfanylidene-1,4-benzoxazin-4-yl]butanoic acid |
| SMILES | CC(C)c1cccc2c1OC(C(C)C)C(=S)N2CCCC(=O)O |
| InChI | InChI=1S/C18H25NO3S/c1-11(2)13-7-5-8-14-17(13)22-16(12(3)4)18(23)19(14)10-6-9-15(20)21/h5,7-8,11-12,16H,6,9-10H2,1-4H3,(H,20,21) |
| InChIKey | JGGQOEQRLSHJKM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|