C12H15ClN2O5S — CID 24738114
(2S,4R)-1-(2-amino-5-chloro-4-methylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 24738114) has the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. Its IUPAC name is (2S,4R)-1-(2-amino-5-chloro-4-methylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-(2-amino-5-chloro-4-methylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 24738114 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (2S,4R)-1-(2-amino-5-chloro-4-methylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | Cc1cc(N)c(S(=O)(=O)N2C[C@H](O)C[C@H]2C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O5S/c1-6-2-9(14)11(4-8(6)13)21(19,20)15-5-7(16)3-10(15)12(17)18/h2,4,7,10,16H,3,5,14H2,1H3,(H,17,18)/t7-,10+/m1/s1 |
| InChIKey | LVYDKUSRCHBKPS-XCBNKYQSSA-N |
| XLogP | 0.44 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|