C22H15F2NO6 — CID 24738394
2-[4-[4-(difluoromethoxy)-9-methoxy-1,3-dioxobenzo[f]isoindol-2-yl]phenyl]acetic acid (PubChem CID 24738394) has the molecular formula C22H15F2NO6 and a molecular weight of 427.36 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)-9-methoxy-1,3-dioxobenzo[f]isoindol-2-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-(difluoromethoxy)-9-methoxy-1,3-dioxobenzo[f]isoindol-2-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 24738394 |
| Molecular Formula | C22H15F2NO6 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)-9-methoxy-1,3-dioxobenzo[f]isoindol-2-yl]phenyl]acetic acid |
| SMILES | COc1c2c(c(OC(F)F)c3ccccc13)C(=O)N(c1ccc(CC(=O)O)cc1)C2=O |
| InChI | InChI=1S/C22H15F2NO6/c1-30-18-13-4-2-3-5-14(13)19(31-22(23)24)17-16(18)20(28)25(21(17)29)12-8-6-11(7-9-12)10-15(26)27/h2-9,22H,10H2,1H3,(H,26,27) |
| InChIKey | YGRRNFJSRRIQSC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|