C25H23F5N6O — CID 24738786
4-[[4-[4-[2-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-3-yl]phenoxy]piperidin-1-yl]methyl]pyridin-2-amine (PubChem CID 24738786) has the molecular formula C25H23F5N6O and a molecular weight of 518.49 g/mol. Its IUPAC name is 4-[[4-[4-[2-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-3-yl]phenoxy]piperidin-1-yl]methyl]pyridin-2-amine.
| Compound Name | 4-[[4-[4-[2-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-3-yl]phenoxy]piperidin-1-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 24738786 |
| Molecular Formula | C25H23F5N6O |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 4-[[4-[4-[2-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-3-yl]phenoxy]piperidin-1-yl]methyl]pyridin-2-amine |
| SMILES | Nc1cc(CN2CCC(Oc3ccc(-n4c(C(F)(F)C(F)(F)F)nc5cccnc54)cc3)CC2)ccn1 |
| InChI | InChI=1S/C25H23F5N6O/c26-24(27,25(28,29)30)23-34-20-2-1-10-33-22(20)36(23)17-3-5-18(6-4-17)37-19-8-12-35(13-9-19)15-16-7-11-32-21(31)14-16/h1-7,10-11,14,19H,8-9,12-13,15H2,(H2,31,32) |
| InChIKey | YRCXGYRGESOUIN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|