About 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole
4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole (PubChem CID 24738828) has the molecular formula C17H12BrN3O
and a molecular weight of 354.21 g/mol. Its IUPAC name is 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole |
| PubChem CID | 24738828 |
| Molecular Formula | C17H12BrN3O |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole |
| SMILES | Cc1onc(-c2ccccc2)c1-c1cn2ccc(Br)cc2n1 |
| InChI | InChI=1S/C17H12BrN3O/c1-11-16(17(20-22-11)12-5-3-2-4-6-12)14-10-21-8-7-13(18)9-15(21)19-14/h2-10H,1H3 |
| InChIKey | SAFCPWPXBRAYPU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole?
The IUPAC name of 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole (CID 24738828) is 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole.
What is the SMILES notation for 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole?
The canonical SMILES for 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole is Cc1onc(-c2ccccc2)c1-c1cn2ccc(Br)cc2n1.
What is the InChIKey of 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole?
The InChIKey is SAFCPWPXBRAYPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrN3O/c1-11-16(17(20-22-11)12-5-3-2-4-6-12)14-10-21-8-7-13(18)9-15(21)19-14/h2-10H,1H3.
What are the key properties of 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole?
4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole has a molecular weight of 354.21 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-bromoimidazo[1,2-a]pyridin-2-yl)-5-methyl-3-phenyl-1,2-oxazole is sourced from PubChem (CID 24738828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).