About 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate
3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate (PubChem CID 24738938) has the molecular formula C19H25N2O2-
and a molecular weight of 313.42 g/mol. Its IUPAC name is 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate |
| PubChem CID | 24738938 |
| Molecular Formula | C19H25N2O2- |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate |
| SMILES | Cc1cccc([C@@H](C)c2nccn2C(C)C(C)(C)C(=O)[O-])c1C |
| InChI | InChI=1S/C19H26N2O2/c1-12-8-7-9-16(13(12)2)14(3)17-20-10-11-21(17)15(4)19(5,6)18(22)23/h7-11,14-15H,1-6H3,(H,22,23)/p-1/t14-,15?/m1/s1 |
| InChIKey | NHZPUIFJVWUENY-GICMACPYSA-M |
| XLogP | 2.99 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate?
The IUPAC name of 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate (CID 24738938) is 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate.
What is the SMILES notation for 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate?
The canonical SMILES for 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate is Cc1cccc([C@@H](C)c2nccn2C(C)C(C)(C)C(=O)[O-])c1C.
What is the InChIKey of 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate?
The InChIKey is NHZPUIFJVWUENY-GICMACPYSA-M. The full InChI is InChI=1S/C19H26N2O2/c1-12-8-7-9-16(13(12)2)14(3)17-20-10-11-21(17)15(4)19(5,6)18(22)23/h7-11,14-15H,1-6H3,(H,22,23)/p-1/t14-,15?/m1/s1.
What are the key properties of 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate?
3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate has a molecular weight of 313.42 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(1R)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]-2,2-dimethylbutanoate is sourced from PubChem (CID 24738938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).