C25H24O9 — CID 24739267
[(1S,2R)-7-acetyloxy-1-(4-acetyloxy-3-methoxyphenyl)-3-formyl-6-methoxy-1,2-dihydronaphthalen-2-yl] acetate (PubChem CID 24739267) has the molecular formula C25H24O9 and a molecular weight of 468.46 g/mol. Its IUPAC name is [(1S,2R)-7-acetyloxy-1-(4-acetyloxy-3-methoxyphenyl)-3-formyl-6-methoxy-1,2-dihydronaphthalen-2-yl] acetate.
| Compound Name | [(1S,2R)-7-acetyloxy-1-(4-acetyloxy-3-methoxyphenyl)-3-formyl-6-methoxy-1,2-dihydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 24739267 |
| Molecular Formula | C25H24O9 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [(1S,2R)-7-acetyloxy-1-(4-acetyloxy-3-methoxyphenyl)-3-formyl-6-methoxy-1,2-dihydronaphthalen-2-yl] acetate |
| SMILES | COc1cc([C@H]2c3cc(OC(C)=O)c(OC)cc3C=C(C=O)[C@@H]2OC(C)=O)ccc1OC(C)=O |
| InChI | InChI=1S/C25H24O9/c1-13(27)32-20-7-6-16(9-21(20)30-4)24-19-11-23(33-14(2)28)22(31-5)10-17(19)8-18(12-26)25(24)34-15(3)29/h6-12,24-25H,1-5H3/t24-,25-/m0/s1 |
| InChIKey | ZACBJWLMLGPLIU-DQEYMECFSA-N |
| XLogP | 3.21 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|