C17H17N3O3S2 — CID 2473928
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(4-methylquinolin-2-yl)sulfanylacetamide (PubChem CID 2473928) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(4-methylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(4-methylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2473928 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-(4-methylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)NCCN2C(=O)CSC2=O)nc2ccccc12 |
| InChI | InChI=1S/C17H17N3O3S2/c1-11-8-15(19-13-5-3-2-4-12(11)13)24-9-14(21)18-6-7-20-16(22)10-25-17(20)23/h2-5,8H,6-7,9-10H2,1H3,(H,18,21) |
| InChIKey | DCAXTFUXRSWCKA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|