About 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine
4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine (PubChem CID 2473929) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine |
| PubChem CID | 2473929 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(N/C=C\Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-19(2)17-12-10-16(11-13-17)18-14-6-9-15-7-4-3-5-8-15/h3-8,10-14,18H,9H2,1-2H3/b14-6- |
| InChIKey | XTAXMOGBYJRRPO-NSIKDUERSA-N |
| XLogP | 3.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine?
The IUPAC name of 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine (CID 2473929) is 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine.
What is the SMILES notation for 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine?
The canonical SMILES for 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine is CN(C)c1ccc(N/C=C\Cc2ccccc2)cc1.
What is the InChIKey of 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine?
The InChIKey is XTAXMOGBYJRRPO-NSIKDUERSA-N. The full InChI is InChI=1S/C17H20N2/c1-19(2)17-12-10-16(11-13-17)18-14-6-9-15-7-4-3-5-8-15/h3-8,10-14,18H,9H2,1-2H3/b14-6-.
What are the key properties of 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine?
4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine has a molecular weight of 252.36 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dimethyl-1-N-[(Z)-3-phenylprop-1-enyl]benzene-1,4-diamine is sourced from PubChem (CID 2473929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).