C17H15FIN3O4S — CID 24739538
N-(2,3-dihydroxypropyl)-2-(2-fluoro-4-iodoanilino)-7-oxidothieno[2,3-b]pyridin-7-ium-3-carboxamide (PubChem CID 24739538) has the molecular formula C17H15FIN3O4S and a molecular weight of 503.29 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-(2-fluoro-4-iodoanilino)-7-oxidothieno[2,3-b]pyridin-7-ium-3-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-(2-fluoro-4-iodoanilino)-7-oxidothieno[2,3-b]pyridin-7-ium-3-carboxamide |
|---|---|
| PubChem CID | 24739538 |
| Molecular Formula | C17H15FIN3O4S |
| Molecular Weight | 503.29 g/mol |
| Exact Mass | 502.98 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-(2-fluoro-4-iodoanilino)-7-oxidothieno[2,3-b]pyridin-7-ium-3-carboxamide |
| SMILES | O=C(NCC(O)CO)c1c(Nc2ccc(I)cc2F)sc2c1ccc[n+]2[O-] |
| InChI | InChI=1S/C17H15FIN3O4S/c18-12-6-9(19)3-4-13(12)21-16-14(15(25)20-7-10(24)8-23)11-2-1-5-22(26)17(11)27-16/h1-6,10,21,23-24H,7-8H2,(H,20,25) |
| InChIKey | DSFARCMBHVALBC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|