C31H44ClN3O3 — CID 24739564
2-(diethylamino)ethyl 4-(chloroamino)benzoate;(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 24739564) has the molecular formula C31H44ClN3O3 and a molecular weight of 542.16 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-(chloroamino)benzoate;(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | 2-(diethylamino)ethyl 4-(chloroamino)benzoate;(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 24739564 |
| Molecular Formula | C31H44ClN3O3 |
| Molecular Weight | 542.16 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 2-(diethylamino)ethyl 4-(chloroamino)benzoate;(1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NCl)cc1.COc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)N(C)CC3 |
| InChI | InChI=1S/C18H25NO.C13H19ClN2O2/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18;1-3-16(4-2)9-10-18-13(17)11-5-7-12(15-14)8-6-11/h6-7,12,15,17H,3-5,8-11H2,1-2H3;5-8,15H,3-4,9-10H2,1-2H3/t15-,17+,18+;/m1./s1 |
| InChIKey | ARNKWGDGDOUHKZ-URVXVIKDSA-N |
| XLogP | 6.13 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.16 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|