C21H24O9 — CID 24739711
(E)-3-(4-hydroxyphenyl)-1-[6-hydroxy-4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexa-2,4-dien-1-yl]prop-2-en-1-one (PubChem CID 24739711) has the molecular formula C21H24O9 and a molecular weight of 420.41 g/mol. Its IUPAC name is (E)-3-(4-hydroxyphenyl)-1-[6-hydroxy-4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexa-2,4-dien-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-hydroxyphenyl)-1-[6-hydroxy-4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexa-2,4-dien-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 24739711 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)-1-[6-hydroxy-4-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexa-2,4-dien-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)cc1)C1C=CC(OC2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)=CC1O |
| InChI | InChI=1S/C21H24O9/c22-10-17-18(26)19(27)20(28)21(30-17)29-13-6-7-14(16(25)9-13)15(24)8-3-11-1-4-12(23)5-2-11/h1-9,14,16-23,25-28H,10H2/b8-3+/t14?,16?,17-,18+,19+,20-,21?/m1/s1 |
| InChIKey | UGXRGOISRRFJSP-RUPYEWGUSA-N |
| XLogP | -0.78 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|