C25H30N4O3 — CID 24740047
[10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] 2,2-dimethylpropanoate (PubChem CID 24740047) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] 2,2-dimethylpropanoate.
| Compound Name | [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24740047 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl] 2,2-dimethylpropanoate |
| SMILES | CCN(CC)CCNc1ccc2ncn3c4ccc(OC(=O)C(C)(C)C)cc4c(=O)c1c23 |
| InChI | InChI=1S/C25H30N4O3/c1-6-28(7-2)13-12-26-18-9-10-19-22-21(18)23(30)17-14-16(32-24(31)25(3,4)5)8-11-20(17)29(22)15-27-19/h8-11,14-15,26H,6-7,12-13H2,1-5H3 |
| InChIKey | JMTWYULQTLBTLS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|