C26H32N4O4 — CID 24740051
[10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 24740051) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24740051 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [10-[2-(diethylamino)ethylamino]-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CCN(CC)CCNc1ccc2ncn3c4ccc(OCOC(=O)C(C)(C)C)cc4c(=O)c1c23 |
| InChI | InChI=1S/C26H32N4O4/c1-6-29(7-2)13-12-27-19-9-10-20-23-22(19)24(31)18-14-17(8-11-21(18)30(23)15-28-20)33-16-34-25(32)26(3,4)5/h8-11,14-15,27H,6-7,12-13,16H2,1-5H3 |
| InChIKey | PDMNKIMVLZVVFB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|