(E)-2,4,6-trimethyloct-2-enoic acid

C11H20O2 — CID 24740399

IUPAC(E)-2,4,6-trimethyloct-2-enoic acid
SMILESCCC(C)CC(C)/C=C(\C)C(=O)O
InChIInChI=1S/C11H20O2/c1-5-8(2)6-9(3)7-10(4)11(12)13/h7-9H,5-6H2,1-4H3,(H,12,13)/b10-7+
InChIKeyJFYAXXZUKVGZAG-JXMROGBWSA-N
MW184.28 g/mol
LogP3.09
Rot. Bonds5

About (E)-2,4,6-trimethyloct-2-enoic acid

(E)-2,4,6-trimethyloct-2-enoic acid (PubChem CID 24740399) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-2,4,6-trimethyloct-2-enoic acid.

Molecular Properties

Compound Name(E)-2,4,6-trimethyloct-2-enoic acid
PubChem CID24740399
Molecular FormulaC11H20O2
Molecular Weight184.28 g/mol
Exact Mass184.15
IUPAC Name(E)-2,4,6-trimethyloct-2-enoic acid
SMILESCCC(C)CC(C)/C=C(\C)C(=O)O
InChIInChI=1S/C11H20O2/c1-5-8(2)6-9(3)7-10(4)11(12)13/h7-9H,5-6H2,1-4H3,(H,12,13)/b10-7+
InChIKeyJFYAXXZUKVGZAG-JXMROGBWSA-N
XLogP3.09
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.28
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-2,4,6-trimethyloct-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2,4,6-trimethyloct-2-enoic acid?
The IUPAC name of (E)-2,4,6-trimethyloct-2-enoic acid (CID 24740399) is (E)-2,4,6-trimethyloct-2-enoic acid.
What is the SMILES notation for (E)-2,4,6-trimethyloct-2-enoic acid?
The canonical SMILES for (E)-2,4,6-trimethyloct-2-enoic acid is CCC(C)CC(C)/C=C(\C)C(=O)O.
What is the InChIKey of (E)-2,4,6-trimethyloct-2-enoic acid?
The InChIKey is JFYAXXZUKVGZAG-JXMROGBWSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-8(2)6-9(3)7-10(4)11(12)13/h7-9H,5-6H2,1-4H3,(H,12,13)/b10-7+.
What are the key properties of (E)-2,4,6-trimethyloct-2-enoic acid?
(E)-2,4,6-trimethyloct-2-enoic acid has a molecular weight of 184.28 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,4,6-trimethyloct-2-enoic acid is sourced from PubChem (CID 24740399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).