C13H15IN4O — CID 24740445
[(1S,3R,4R)-3-iodo-4-(4-pyridin-2-yltriazol-1-yl)cyclopentyl]methanol (PubChem CID 24740445) has the molecular formula C13H15IN4O and a molecular weight of 370.19 g/mol. Its IUPAC name is [(1S,3R,4R)-3-iodo-4-(4-pyridin-2-yltriazol-1-yl)cyclopentyl]methanol.
| Compound Name | [(1S,3R,4R)-3-iodo-4-(4-pyridin-2-yltriazol-1-yl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 24740445 |
| Molecular Formula | C13H15IN4O |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [(1S,3R,4R)-3-iodo-4-(4-pyridin-2-yltriazol-1-yl)cyclopentyl]methanol |
| SMILES | OC[C@@H]1C[C@@H](I)[C@H](n2cc(-c3ccccn3)nn2)C1 |
| InChI | InChI=1S/C13H15IN4O/c14-10-5-9(8-19)6-13(10)18-7-12(16-17-18)11-3-1-2-4-15-11/h1-4,7,9-10,13,19H,5-6,8H2/t9-,10-,13-/m1/s1 |
| InChIKey | RYHPTSYVMLHMHR-GIPNMCIBSA-N |
| XLogP | 2.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|