C16H25IO2 — CID 24740597
(2R,6R)-2-[(1E,3Z,5S)-6-iodo-3,5-dimethylhexa-1,3-dienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran (PubChem CID 24740597) has the molecular formula C16H25IO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is (2R,6R)-2-[(1E,3Z,5S)-6-iodo-3,5-dimethylhexa-1,3-dienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-2-[(1E,3Z,5S)-6-iodo-3,5-dimethylhexa-1,3-dienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 24740597 |
| Molecular Formula | C16H25IO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2R,6R)-2-[(1E,3Z,5S)-6-iodo-3,5-dimethylhexa-1,3-dienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
| SMILES | CC(=C/[C@H](C)CI)/C=C/[C@H]1CC=C[C@H](OC(C)C)O1 |
| InChI | InChI=1S/C16H25IO2/c1-12(2)18-16-7-5-6-15(19-16)9-8-13(3)10-14(4)11-17/h5,7-10,12,14-16H,6,11H2,1-4H3/b9-8+,13-10-/t14-,15+,16+/m0/s1 |
| InChIKey | DIPHRMCUHFFYBH-VLGPMISOSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|