About triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane
triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane (PubChem CID 24740710) has the molecular formula C14H24O2Si
and a molecular weight of 252.43 g/mol. Its IUPAC name is triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane.
Molecular Properties
| Compound Name | triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane |
| PubChem CID | 24740710 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane |
| SMILES | CC[Si](C#C[C@H]1CC=C[C@@H](OC)O1)(CC)CC |
| InChI | InChI=1S/C14H24O2Si/c1-5-17(6-2,7-3)12-11-13-9-8-10-14(15-4)16-13/h8,10,13-14H,5-7,9H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | CEYICUHJZXKDSF-KGLIPLIRSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane?
The IUPAC name of triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane (CID 24740710) is triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane.
What is the SMILES notation for triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane?
The canonical SMILES for triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane is CC[Si](C#C[C@H]1CC=C[C@@H](OC)O1)(CC)CC.
What is the InChIKey of triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane?
The InChIKey is CEYICUHJZXKDSF-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H24O2Si/c1-5-17(6-2,7-3)12-11-13-9-8-10-14(15-4)16-13/h8,10,13-14H,5-7,9H2,1-4H3/t13-,14+/m1/s1.
What are the key properties of triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane?
triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane has a molecular weight of 252.43 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[2-[(2R,6S)-6-methoxy-3,6-dihydro-2H-pyran-2-yl]ethynyl]silane is sourced from PubChem (CID 24740710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).