About [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane
[(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 24740711) has the molecular formula C14H28Br2OSi
and a molecular weight of 400.27 g/mol. Its IUPAC name is [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane |
| PubChem CID | 24740711 |
| Molecular Formula | C14H28Br2OSi |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@@H](C)C=C(Br)Br)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H28Br2OSi/c1-10(2)18(11(3)4,12(5)6)17-9-13(7)8-14(15)16/h8,10-13H,9H2,1-7H3/t13-/m0/s1 |
| InChIKey | UAIISBKGNSVBNW-ZDUSSCGKSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane?
The IUPAC name of [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane (CID 24740711) is [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane.
What is the SMILES notation for [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane?
The canonical SMILES for [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane is CC(C)[Si](OC[C@@H](C)C=C(Br)Br)(C(C)C)C(C)C.
What is the InChIKey of [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane?
The InChIKey is UAIISBKGNSVBNW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H28Br2OSi/c1-10(2)18(11(3)4,12(5)6)17-9-13(7)8-14(15)16/h8,10-13H,9H2,1-7H3/t13-/m0/s1.
What are the key properties of [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane?
[(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane has a molecular weight of 400.27 g/mol, XLogP of 6.45, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4,4-dibromo-2-methylbut-3-enoxy]-tri(propan-2-yl)silane is sourced from PubChem (CID 24740711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).