C24H43BrO3Si — CID 24740712
[(2S,3Z,5E)-4-bromo-2-methyl-6-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane (PubChem CID 24740712) has the molecular formula C24H43BrO3Si and a molecular weight of 487.60 g/mol. Its IUPAC name is [(2S,3Z,5E)-4-bromo-2-methyl-6-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2S,3Z,5E)-4-bromo-2-methyl-6-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 24740712 |
| Molecular Formula | C24H43BrO3Si |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [(2S,3Z,5E)-4-bromo-2-methyl-6-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)O[C@H]1C=CC[C@H](/C=C/C(Br)=C/[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C24H43BrO3Si/c1-17(2)27-24-12-10-11-23(28-24)14-13-22(25)15-21(9)16-26-29(18(3)4,19(5)6)20(7)8/h10,12-15,17-21,23-24H,11,16H2,1-9H3/b14-13+,22-15-/t21-,23+,24+/m0/s1 |
| InChIKey | OFBLDHGLZHJKQU-QUZIXLBSSA-N |
| XLogP | 7.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|