About N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine
N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine (PubChem CID 24740810) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine.
Molecular Properties
| Compound Name | N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine |
| PubChem CID | 24740810 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine |
| SMILES | CCCCCC/C=C/C=C/C=N/N(C)C |
| InChI | InChI=1S/C13H24N2/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h9-13H,4-8H2,1-3H3/b10-9+,12-11+,14-13+ |
| InChIKey | YZVGMLQPVAFKPX-OFYUHDMGSA-N |
| XLogP | 3.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine?
The IUPAC name of N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine (CID 24740810) is N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine.
What is the SMILES notation for N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine?
The canonical SMILES for N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine is CCCCCC/C=C/C=C/C=N/N(C)C.
What is the InChIKey of N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine?
The InChIKey is YZVGMLQPVAFKPX-OFYUHDMGSA-N. The full InChI is InChI=1S/C13H24N2/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h9-13H,4-8H2,1-3H3/b10-9+,12-11+,14-13+.
What are the key properties of N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine?
N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine has a molecular weight of 208.35 g/mol, XLogP of 3.62, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(E)-[(2E,4E)-undeca-2,4-dienylidene]amino]methanamine is sourced from PubChem (CID 24740810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).