C20H23N3O2 — CID 24740995
tert-butyl (1R,8S,9R)-9-(6-amino-3-pyridinyl)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-11-carboxylate (PubChem CID 24740995) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl (1R,8S,9R)-9-(6-amino-3-pyridinyl)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-11-carboxylate.
| Compound Name | tert-butyl (1R,8S,9R)-9-(6-amino-3-pyridinyl)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 24740995 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | tert-butyl (1R,8S,9R)-9-(6-amino-3-pyridinyl)-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@H](c3ccc(N)nc3)[C@H]1c1ccccc12 |
| InChI | InChI=1S/C20H23N3O2/c1-20(2,3)25-19(24)23-16-10-15(12-8-9-17(21)22-11-12)18(23)14-7-5-4-6-13(14)16/h4-9,11,15-16,18H,10H2,1-3H3,(H2,21,22)/t15-,16-,18-/m1/s1 |
| InChIKey | XGKGHIVDAOUOJY-JFIYKMOQSA-N |
| XLogP | 4.18 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |