C28H42O6S — CID 24741096
(2R,4S)-4-(benzenesulfonyl)-2-[(6S,9R)-9-methyl-1,4-dioxaspiro[4.5]decan-6-yl]-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-1-ol (PubChem CID 24741096) has the molecular formula C28H42O6S and a molecular weight of 506.71 g/mol. Its IUPAC name is (2R,4S)-4-(benzenesulfonyl)-2-[(6S,9R)-9-methyl-1,4-dioxaspiro[4.5]decan-6-yl]-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-1-ol.
| Compound Name | (2R,4S)-4-(benzenesulfonyl)-2-[(6S,9R)-9-methyl-1,4-dioxaspiro[4.5]decan-6-yl]-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 24741096 |
| Molecular Formula | C28H42O6S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | (2R,4S)-4-(benzenesulfonyl)-2-[(6S,9R)-9-methyl-1,4-dioxaspiro[4.5]decan-6-yl]-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-1-ol |
| SMILES | C[C@@H]1CC[C@@H]([C@H](CO)C[C@@H]([C@@H]2[C@@H](C)[C@]3(C)CC[C@@]2(C)O3)S(=O)(=O)c2ccccc2)C2(C1)OCCO2 |
| InChI | InChI=1S/C28H42O6S/c1-19-10-11-23(28(17-19)32-14-15-33-28)21(18-29)16-24(35(30,31)22-8-6-5-7-9-22)25-20(2)26(3)12-13-27(25,4)34-26/h5-9,19-21,23-25,29H,10-18H2,1-4H3/t19-,20-,21+,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | AAPBQNHPEWBONP-MHLRRGRVSA-N |
| XLogP | 4.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |