C36H52O5Si — CID 24741273
(2S,6R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-[(2S)-2-methoxy-3-[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]propyl]oxan-4-one (PubChem CID 24741273) has the molecular formula C36H52O5Si and a molecular weight of 592.89 g/mol. Its IUPAC name is (2S,6R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-[(2S)-2-methoxy-3-[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]propyl]oxan-4-one.
| Compound Name | (2S,6R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-[(2S)-2-methoxy-3-[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]propyl]oxan-4-one |
|---|---|
| PubChem CID | 24741273 |
| Molecular Formula | C36H52O5Si |
| Molecular Weight | 592.89 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | (2S,6R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-[(2S)-2-methoxy-3-[(2R,3S,6S)-3-methyl-6-prop-2-enyloxan-2-yl]propyl]oxan-4-one |
| SMILES | C=CC[C@@H]1CC[C@H](C)[C@@H](C[C@H](C[C@@H]2CC(=O)C[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)OC)O1 |
| InChI | InChI=1S/C36H52O5Si/c1-7-14-29-20-19-27(2)35(41-29)26-31(38-6)25-32-24-28(37)23-30(40-32)21-22-39-42(36(3,4)5,33-15-10-8-11-16-33)34-17-12-9-13-18-34/h7-13,15-18,27,29-32,35H,1,14,19-26H2,2-6H3/t27-,29+,30-,31-,32-,35+/m0/s1 |
| InChIKey | SDZGBPWTSYCDNO-YTFFEWMLSA-N |
| XLogP | 6.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.89 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|