C13H21NO3 — CID 24741569
(2R)-2-(3,3-dimethoxypropylamino)-2-phenylethanol (PubChem CID 24741569) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (2R)-2-(3,3-dimethoxypropylamino)-2-phenylethanol.
| Compound Name | (2R)-2-(3,3-dimethoxypropylamino)-2-phenylethanol |
|---|---|
| PubChem CID | 24741569 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (2R)-2-(3,3-dimethoxypropylamino)-2-phenylethanol |
| SMILES | COC(CCN[C@@H](CO)c1ccccc1)OC |
| InChI | InChI=1S/C13H21NO3/c1-16-13(17-2)8-9-14-12(10-15)11-6-4-3-5-7-11/h3-7,12-15H,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | IIVBVAHWBUFDLC-LBPRGKRZSA-N |
| XLogP | 1.32 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|