About octadecanediimidamide;dihydrochloride
octadecanediimidamide;dihydrochloride (PubChem CID 24741615) has the molecular formula C18H40Cl2N4
and a molecular weight of 383.45 g/mol. Its IUPAC name is octadecanediimidamide;dihydrochloride.
Molecular Properties
| Compound Name | octadecanediimidamide;dihydrochloride |
| PubChem CID | 24741615 |
| Molecular Formula | C18H40Cl2N4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | octadecanediimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)CCCCCCCCCCCCCCCC/C(N)=N/[H] |
| InChI | InChI=1S/C18H38N4.2ClH/c19-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22;;/h1-16H2,(H3,19,20)(H3,21,22);2*1H |
| InChIKey | HSRMSBXQWYLBRH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze octadecanediimidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanediimidamide;dihydrochloride?
The IUPAC name of octadecanediimidamide;dihydrochloride (CID 24741615) is octadecanediimidamide;dihydrochloride.
What is the SMILES notation for octadecanediimidamide;dihydrochloride?
The canonical SMILES for octadecanediimidamide;dihydrochloride is Cl.Cl.[H]/N=C(\N)CCCCCCCCCCCCCCCC/C(N)=N/[H].
What is the InChIKey of octadecanediimidamide;dihydrochloride?
The InChIKey is HSRMSBXQWYLBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N4.2ClH/c19-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22;;/h1-16H2,(H3,19,20)(H3,21,22);2*1H.
What are the key properties of octadecanediimidamide;dihydrochloride?
octadecanediimidamide;dihydrochloride has a molecular weight of 383.45 g/mol, XLogP of 5.94, 17 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanediimidamide;dihydrochloride is sourced from PubChem (CID 24741615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).