C28H40O5S — CID 24741692
(6S,9R)-6-[(4S)-4-(benzenesulfonyl)-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-1-en-2-yl]-9-methyl-1,4-dioxaspiro[4.5]decane (PubChem CID 24741692) has the molecular formula C28H40O5S and a molecular weight of 488.69 g/mol. Its IUPAC name is (6S,9R)-6-[(4S)-4-(benzenesulfonyl)-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-1-en-2-yl]-9-methyl-1,4-dioxaspiro[4.5]decane.
| Compound Name | (6S,9R)-6-[(4S)-4-(benzenesulfonyl)-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-1-en-2-yl]-9-methyl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 24741692 |
| Molecular Formula | C28H40O5S |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (6S,9R)-6-[(4S)-4-(benzenesulfonyl)-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-1-en-2-yl]-9-methyl-1,4-dioxaspiro[4.5]decane |
| SMILES | C=C(C[C@@H]([C@@H]1[C@@H](C)[C@]2(C)CC[C@@]1(C)O2)S(=O)(=O)c1ccccc1)[C@@H]1CC[C@@H](C)CC12OCCO2 |
| InChI | InChI=1S/C28H40O5S/c1-19-11-12-23(28(18-19)31-15-16-32-28)20(2)17-24(34(29,30)22-9-7-6-8-10-22)25-21(3)26(4)13-14-27(25,5)33-26/h6-10,19,21,23-25H,2,11-18H2,1,3-5H3/t19-,21-,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | WXZHFVSQRPACTN-XWMUOLITSA-N |
| XLogP | 5.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|