C25H32N2O4S — CID 24741711
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-N-methoxysulfanyl-2,7-dimethyl-2,3-dihydro-1-benzofuran-6-carbohydrazide (PubChem CID 24741711) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-N-methoxysulfanyl-2,7-dimethyl-2,3-dihydro-1-benzofuran-6-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-N-methoxysulfanyl-2,7-dimethyl-2,3-dihydro-1-benzofuran-6-carbohydrazide |
|---|---|
| PubChem CID | 24741711 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-N-methoxysulfanyl-2,7-dimethyl-2,3-dihydro-1-benzofuran-6-carbohydrazide |
| SMILES | COSN(C(=O)c1ccc2c(c1C)OC(C)C2)N(C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C25H32N2O4S/c1-15-11-16(2)13-20(12-15)23(28)26(25(5,6)7)27(32-30-8)24(29)21-10-9-19-14-17(3)31-22(19)18(21)4/h9-13,17H,14H2,1-8H3 |
| InChIKey | KDKMRRCLMNGTEA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|