C28H46O5Si — CID 24741783
[(1R,2R,3S,5S,8S,10S)-5-hydroxy-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-triethylsilyloxy-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 24741783) has the molecular formula C28H46O5Si and a molecular weight of 490.76 g/mol. Its IUPAC name is [(1R,2R,3S,5S,8S,10S)-5-hydroxy-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-triethylsilyloxy-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [(1R,2R,3S,5S,8S,10S)-5-hydroxy-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-triethylsilyloxy-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 24741783 |
| Molecular Formula | C28H46O5Si |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | [(1R,2R,3S,5S,8S,10S)-5-hydroxy-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-triethylsilyloxy-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | C=C1[C@@H](O)CC[C@@]2(C)C[C@H](O[Si](CC)(CC)CC)C3=C(C)C(=O)C[C@@H]([C@@H](OC(C)=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C28H46O5Si/c1-10-34(11-2,12-3)33-23-16-28(9)14-13-21(30)17(4)25(28)26(32-19(6)29)20-15-22(31)18(5)24(23)27(20,7)8/h20-21,23,25-26,30H,4,10-16H2,1-3,5-9H3/t20-,21-,23-,25-,26+,28-/m0/s1 |
| InChIKey | PKNWATSZLJVVTG-JTIHRVOVSA-N |
| XLogP | 5.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|