C19H29BN2O3Si — CID 24741791
[1-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-4-yl]-trimethylsilane (PubChem CID 24741791) has the molecular formula C19H29BN2O3Si and a molecular weight of 372.35 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-4-yl]-trimethylsilane.
| Compound Name | [1-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 24741791 |
| Molecular Formula | C19H29BN2O3Si |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [1-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-4-yl]-trimethylsilane |
| SMILES | COc1ccc(-n2cc([Si](C)(C)C)c(B3OC(C)(C)C(C)(C)O3)n2)cc1 |
| InChI | InChI=1S/C19H29BN2O3Si/c1-18(2)19(3,4)25-20(24-18)17-16(26(6,7)8)13-22(21-17)14-9-11-15(23-5)12-10-14/h9-13H,1-8H3 |
| InChIKey | SJURUDCUYANIOT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|