About 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene
1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene (PubChem CID 24741912) has the molecular formula C15H23IO4
and a molecular weight of 394.25 g/mol. Its IUPAC name is 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene.
Molecular Properties
| Compound Name | 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene |
| PubChem CID | 24741912 |
| Molecular Formula | C15H23IO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene |
| SMILES | CCOCOc1c(C)c(C)c(OCOCC)c(I)c1C |
| InChI | InChI=1S/C15H23IO4/c1-6-17-8-19-14-10(3)11(4)15(13(16)12(14)5)20-9-18-7-2/h6-9H2,1-5H3 |
| InChIKey | UECVERBHKPPSPY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene?
The IUPAC name of 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene (CID 24741912) is 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene.
What is the SMILES notation for 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene?
The canonical SMILES for 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene is CCOCOc1c(C)c(C)c(OCOCC)c(I)c1C.
What is the InChIKey of 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene?
The InChIKey is UECVERBHKPPSPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23IO4/c1-6-17-8-19-14-10(3)11(4)15(13(16)12(14)5)20-9-18-7-2/h6-9H2,1-5H3.
What are the key properties of 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene?
1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene has a molecular weight of 394.25 g/mol, XLogP of 3.96, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(ethoxymethoxy)-2-iodo-3,5,6-trimethylbenzene is sourced from PubChem (CID 24741912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).