C24H37N3O2 — CID 24742033
(3S,6S)-11-hexyl-6-(hydroxymethyl)-2-methyl-3-propan-2-yl-2,5,11-triazatricyclo[7.6.1.012,16]hexadeca-1(15),9,12(16),13-tetraen-4-one (PubChem CID 24742033) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is (3S,6S)-11-hexyl-6-(hydroxymethyl)-2-methyl-3-propan-2-yl-2,5,11-triazatricyclo[7.6.1.012,16]hexadeca-1(15),9,12(16),13-tetraen-4-one.
| Compound Name | (3S,6S)-11-hexyl-6-(hydroxymethyl)-2-methyl-3-propan-2-yl-2,5,11-triazatricyclo[7.6.1.012,16]hexadeca-1(15),9,12(16),13-tetraen-4-one |
|---|---|
| PubChem CID | 24742033 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | (3S,6S)-11-hexyl-6-(hydroxymethyl)-2-methyl-3-propan-2-yl-2,5,11-triazatricyclo[7.6.1.012,16]hexadeca-1(15),9,12(16),13-tetraen-4-one |
| SMILES | CCCCCCn1cc2c3c(cccc31)N(C)[C@@H](C(C)C)C(=O)N[C@H](CO)CC2 |
| InChI | InChI=1S/C24H37N3O2/c1-5-6-7-8-14-27-15-18-12-13-19(16-28)25-24(29)23(17(2)3)26(4)20-10-9-11-21(27)22(18)20/h9-11,15,17,19,23,28H,5-8,12-14,16H2,1-4H3,(H,25,29)/t19-,23-/m0/s1 |
| InChIKey | MVPSDKPPZLPMBB-CVDCTZTESA-N |
| XLogP | 4.11 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|