C6H8O18P4-8 — CID 24742076
[(1S,2S,4S,5R)-2,4-dihydroxy-3,5,6-triphosphonatooxycyclohexyl] phosphate (PubChem CID 24742076) has the molecular formula C6H8O18P4-8 and a molecular weight of 492.01 g/mol. Its IUPAC name is [(1S,2S,4S,5R)-2,4-dihydroxy-3,5,6-triphosphonatooxycyclohexyl] phosphate.
| Compound Name | [(1S,2S,4S,5R)-2,4-dihydroxy-3,5,6-triphosphonatooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 24742076 |
| Molecular Formula | C6H8O18P4-8 |
| Molecular Weight | 492.01 g/mol |
| Exact Mass | 491.87 |
| IUPAC Name | [(1S,2S,4S,5R)-2,4-dihydroxy-3,5,6-triphosphonatooxycyclohexyl] phosphate |
| SMILES | O=P([O-])([O-])OC1[C@H](O)[C@H](OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])[C@H](OP(=O)([O-])[O-])[C@H]1O |
| InChI | InChI=1S/C6H16O18P4/c7-1-3(21-25(9,10)11)2(8)5(23-27(15,16)17)6(24-28(18,19)20)4(1)22-26(12,13)14/h1-8H,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/p-8/t1-,2-,3?,4-,5+,6?/m0/s1 |
| InChIKey | CIPFCGZLFXVXBG-FTSGZOCFSA-F |
| XLogP | -8.42 |
| TPSA | 330.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.01 |
| LogP ≤ 5 | -8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|