C36H35Cl2F2N3O4 — CID 24742217
4-[4-[[3-(2-chloro-3,6-difluorophenyl)-1,2-oxazol-5-yl]methoxy]phenyl]-N-[[2-chloro-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-1,2,3,6-tetrahydropyridine-5-carboxamide (PubChem CID 24742217) has the molecular formula C36H35Cl2F2N3O4 and a molecular weight of 682.60 g/mol. Its IUPAC name is 4-[4-[[3-(2-chloro-3,6-difluorophenyl)-1,2-oxazol-5-yl]methoxy]phenyl]-N-[[2-chloro-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-1,2,3,6-tetrahydropyridine-5-carboxamide.
| Compound Name | 4-[4-[[3-(2-chloro-3,6-difluorophenyl)-1,2-oxazol-5-yl]methoxy]phenyl]-N-[[2-chloro-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-1,2,3,6-tetrahydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 24742217 |
| Molecular Formula | C36H35Cl2F2N3O4 |
| Molecular Weight | 682.60 g/mol |
| Exact Mass | 681.20 |
| IUPAC Name | 4-[4-[[3-(2-chloro-3,6-difluorophenyl)-1,2-oxazol-5-yl]methoxy]phenyl]-N-[[2-chloro-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-1,2,3,6-tetrahydropyridine-5-carboxamide |
| SMILES | COCCCc1ccc(Cl)c(CN(C(=O)C2=C(c3ccc(OCc4cc(-c5c(F)ccc(F)c5Cl)no4)cc3)CCNC2)C2CC2)c1 |
| InChI | InChI=1S/C36H35Cl2F2N3O4/c1-45-16-2-3-22-4-11-30(37)24(17-22)20-43(25-7-8-25)36(44)29-19-41-15-14-28(29)23-5-9-26(10-6-23)46-21-27-18-33(42-47-27)34-31(39)12-13-32(40)35(34)38/h4-6,9-13,17-18,25,41H,2-3,7-8,14-16,19-21H2,1H3 |
| InChIKey | UAJYHZDMXWSQBM-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.60 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|