About 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium
2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium (PubChem CID 24742691) has the molecular formula C21H24ClN4+
and a molecular weight of 367.90 g/mol. Its IUPAC name is 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium.
Molecular Properties
| Compound Name | 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium |
| PubChem CID | 24742691 |
| Molecular Formula | C21H24ClN4+ |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium |
| SMILES | CCC[N+](C)(C)CCn1c2ccc(Cl)cc2c2nc3ccccc3nc21 |
| InChI | InChI=1S/C21H24ClN4/c1-4-12-26(2,3)13-11-25-19-10-9-15(22)14-16(19)20-21(25)24-18-8-6-5-7-17(18)23-20/h5-10,14H,4,11-13H2,1-3H3/q+1 |
| InChIKey | YLDKEXBBUNVCIY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium?
The IUPAC name of 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium (CID 24742691) is 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium.
What is the SMILES notation for 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium?
The canonical SMILES for 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium is CCC[N+](C)(C)CCn1c2ccc(Cl)cc2c2nc3ccccc3nc21.
What is the InChIKey of 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium?
The InChIKey is YLDKEXBBUNVCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24ClN4/c1-4-12-26(2,3)13-11-25-19-10-9-15(22)14-16(19)20-21(25)24-18-8-6-5-7-17(18)23-20/h5-10,14H,4,11-13H2,1-3H3/q+1.
What are the key properties of 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium?
2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium has a molecular weight of 367.90 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium is sourced from PubChem (CID 24742691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).