C21H24ClN4+ — CID 24742691
2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium (PubChem CID 24742691) has the molecular formula C21H24ClN4+ and a molecular weight of 367.90 g/mol. Its IUPAC name is 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium.
| Compound Name | 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium |
|---|---|
| PubChem CID | 24742691 |
| Molecular Formula | C21H24ClN4+ |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-(9-chloroindolo[3,2-b]quinoxalin-6-yl)ethyl-dimethyl-propylazanium |
| SMILES | CCC[N+](C)(C)CCn1c2ccc(Cl)cc2c2nc3ccccc3nc21 |
| InChI | InChI=1S/C21H24ClN4/c1-4-12-26(2,3)13-11-25-19-10-9-15(22)14-16(19)20-21(25)24-18-8-6-5-7-17(18)23-20/h5-10,14H,4,11-13H2,1-3H3/q+1 |
| InChIKey | YLDKEXBBUNVCIY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|