C24H25F6N5O — CID 24742861
3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-1-bicyclo[2.2.2]octanyl]-5-(4,4,4-trifluorobutan-2-yl)-1,2,4-oxadiazole (PubChem CID 24742861) has the molecular formula C24H25F6N5O and a molecular weight of 513.49 g/mol. Its IUPAC name is 3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-1-bicyclo[2.2.2]octanyl]-5-(4,4,4-trifluorobutan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-1-bicyclo[2.2.2]octanyl]-5-(4,4,4-trifluorobutan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 24742861 |
| Molecular Formula | C24H25F6N5O |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 3-[4-[4-methyl-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-1-bicyclo[2.2.2]octanyl]-5-(4,4,4-trifluorobutan-2-yl)-1,2,4-oxadiazole |
| SMILES | CC(CC(F)(F)F)c1nc(C23CCC(c4nnc(-c5ccccc5C(F)(F)F)n4C)(CC2)CC3)no1 |
| InChI | InChI=1S/C24H25F6N5O/c1-14(13-23(25,26)27)18-31-19(34-36-18)21-7-10-22(11-8-21,12-9-21)20-33-32-17(35(20)2)15-5-3-4-6-16(15)24(28,29)30/h3-6,14H,7-13H2,1-2H3 |
| InChIKey | QHRZNZQZJAYYND-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |