C24H29N5O4 — CID 24742945
2-[(E)-1-(4-benzylpiperazin-1-yl)butylideneamino]oxy-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 24742945) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-[(E)-1-(4-benzylpiperazin-1-yl)butylideneamino]oxy-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-[(E)-1-(4-benzylpiperazin-1-yl)butylideneamino]oxy-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24742945 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2-[(E)-1-(4-benzylpiperazin-1-yl)butylideneamino]oxy-5-ethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCC/C(=N\Oc1nc2oc(=O)cc(CC)c2c(=O)[nH]1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N5O4/c1-3-8-19(29-13-11-28(12-14-29)16-17-9-6-5-7-10-17)27-33-24-25-22(31)21-18(4-2)15-20(30)32-23(21)26-24/h5-7,9-10,15H,3-4,8,11-14,16H2,1-2H3,(H,25,26,31)/b27-19+ |
| InChIKey | BDNBGAJOJGZOIY-ZXVVBBHZSA-N |
| XLogP | 2.75 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|