About [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate
[3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate (PubChem CID 24743) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate |
| PubChem CID | 24743 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate |
| SMILES | CCOC(=O)Nc1cccc(OC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O4/c1-2-21-15(19)18-13-9-6-10-14(11-13)22-16(20)17-12-7-4-3-5-8-12/h3-11H,2H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | WZJZMXBKUWKXTQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate?
The IUPAC name of [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate (CID 24743) is [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate.
What is the SMILES notation for [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate?
The canonical SMILES for [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate is CCOC(=O)Nc1cccc(OC(=O)Nc2ccccc2)c1.
What is the InChIKey of [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate?
The InChIKey is WZJZMXBKUWKXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4/c1-2-21-15(19)18-13-9-6-10-14(11-13)22-16(20)17-12-7-4-3-5-8-12/h3-11H,2H2,1H3,(H,17,20)(H,18,19).
What are the key properties of [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate?
[3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate has a molecular weight of 300.31 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(ethoxycarbonylamino)phenyl] N-phenylcarbamate is sourced from PubChem (CID 24743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).