C19H16ClN3O4S — CID 24743430
N-[(2-chloro-4-methylsulfonylphenyl)methyl]-3-pyrimidin-2-yloxybenzamide (PubChem CID 24743430) has the molecular formula C19H16ClN3O4S and a molecular weight of 417.87 g/mol. Its IUPAC name is N-[(2-chloro-4-methylsulfonylphenyl)methyl]-3-pyrimidin-2-yloxybenzamide.
| Compound Name | N-[(2-chloro-4-methylsulfonylphenyl)methyl]-3-pyrimidin-2-yloxybenzamide |
|---|---|
| PubChem CID | 24743430 |
| Molecular Formula | C19H16ClN3O4S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N-[(2-chloro-4-methylsulfonylphenyl)methyl]-3-pyrimidin-2-yloxybenzamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)c2cccc(Oc3ncccn3)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H16ClN3O4S/c1-28(25,26)16-7-6-14(17(20)11-16)12-23-18(24)13-4-2-5-15(10-13)27-19-21-8-3-9-22-19/h2-11H,12H2,1H3,(H,23,24) |
| InChIKey | MWORKGPZBABQBH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |