About 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole
6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole (PubChem CID 24743700) has the molecular formula C21H19N3O2S2
and a molecular weight of 409.54 g/mol. Its IUPAC name is 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole |
| PubChem CID | 24743700 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole |
| SMILES | CN1CC=C(c2cn(S(=O)(=O)c3ccc4ncsc4c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C21H19N3O2S2/c1-23-10-8-15(9-11-23)18-13-24(20-5-3-2-4-17(18)20)28(25,26)16-6-7-19-21(12-16)27-14-22-19/h2-8,12-14H,9-11H2,1H3 |
| InChIKey | KOKSZMUFTKRPMO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole?
The IUPAC name of 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole (CID 24743700) is 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole.
What is the SMILES notation for 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole?
The canonical SMILES for 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole is CN1CC=C(c2cn(S(=O)(=O)c3ccc4ncsc4c3)c3ccccc23)CC1.
What is the InChIKey of 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole?
The InChIKey is KOKSZMUFTKRPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2S2/c1-23-10-8-15(9-11-23)18-13-24(20-5-3-2-4-17(18)20)28(25,26)16-6-7-19-21(12-16)27-14-22-19/h2-8,12-14H,9-11H2,1H3.
What are the key properties of 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole?
6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole has a molecular weight of 409.54 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]sulfonyl-1,3-benzothiazole is sourced from PubChem (CID 24743700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).