C21H28N6 — CID 24743743
(3aR,6aR)-5-methyl-1-[4-(4-pyrimidin-5-ylpiperazin-1-yl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 24743743) has the molecular formula C21H28N6 and a molecular weight of 364.50 g/mol. Its IUPAC name is (3aR,6aR)-5-methyl-1-[4-(4-pyrimidin-5-ylpiperazin-1-yl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-5-methyl-1-[4-(4-pyrimidin-5-ylpiperazin-1-yl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 24743743 |
| Molecular Formula | C21H28N6 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (3aR,6aR)-5-methyl-1-[4-(4-pyrimidin-5-ylpiperazin-1-yl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CN1C[C@H]2CCN(c3ccc(N4CCN(c5cncnc5)CC4)cc3)[C@H]2C1 |
| InChI | InChI=1S/C21H28N6/c1-24-14-17-6-7-27(21(17)15-24)19-4-2-18(3-5-19)25-8-10-26(11-9-25)20-12-22-16-23-13-20/h2-5,12-13,16-17,21H,6-11,14-15H2,1H3/t17-,21+/m1/s1 |
| InChIKey | XSVREVYJGGNVMF-UTKZUKDTSA-N |
| XLogP | 1.94 |
| TPSA | 38.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|