C20H24N2 — CID 24743745
(3aR,6aR)-1-(4-benzylphenyl)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 24743745) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (3aR,6aR)-1-(4-benzylphenyl)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-1-(4-benzylphenyl)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 24743745 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3aR,6aR)-1-(4-benzylphenyl)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CN1C[C@H]2CCN(c3ccc(Cc4ccccc4)cc3)[C@H]2C1 |
| InChI | InChI=1S/C20H24N2/c1-21-14-18-11-12-22(20(18)15-21)19-9-7-17(8-10-19)13-16-5-3-2-4-6-16/h2-10,18,20H,11-15H2,1H3/t18-,20+/m1/s1 |
| InChIKey | RSDBWOAXNDPNNE-QUCCMNQESA-N |
| XLogP | 3.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|