About 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine
6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine (PubChem CID 24744414) has the molecular formula C25H30N2
and a molecular weight of 358.53 g/mol. Its IUPAC name is 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine |
| PubChem CID | 24744414 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine |
| SMILES | Cc1cccc(C)c1-c1cccc(Nc2c(C(C)C)cccc2C(C)C)n1 |
| InChI | InChI=1S/C25H30N2/c1-16(2)20-12-8-13-21(17(3)4)25(20)27-23-15-9-14-22(26-23)24-18(5)10-7-11-19(24)6/h7-17H,1-6H3,(H,26,27) |
| InChIKey | UWZJQFOODLGVBS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine?
The IUPAC name of 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine (CID 24744414) is 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine.
What is the SMILES notation for 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine?
The canonical SMILES for 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine is Cc1cccc(C)c1-c1cccc(Nc2c(C(C)C)cccc2C(C)C)n1.
What is the InChIKey of 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine?
The InChIKey is UWZJQFOODLGVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2/c1-16(2)20-12-8-13-21(17(3)4)25(20)27-23-15-9-14-22(26-23)24-18(5)10-7-11-19(24)6/h7-17H,1-6H3,(H,26,27).
What are the key properties of 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine?
6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine has a molecular weight of 358.53 g/mol, XLogP of 7.36, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dimethylphenyl)-N-[2,6-di(propan-2-yl)phenyl]pyridin-2-amine is sourced from PubChem (CID 24744414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).