About 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide
5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 24744458) has the molecular formula C8H8N4OS
and a molecular weight of 208.25 g/mol. Its IUPAC name is 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide |
| PubChem CID | 24744458 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nccs2)n[nH]1 |
| InChI | InChI=1S/C8H8N4OS/c1-5-4-6(12-11-5)7(13)10-8-9-2-3-14-8/h2-4H,1H3,(H,11,12)(H,9,10,13) |
| InChIKey | DLWVINILGBVQRW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide?
The IUPAC name of 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide (CID 24744458) is 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide?
The canonical SMILES for 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide is Cc1cc(C(=O)Nc2nccs2)n[nH]1.
What is the InChIKey of 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide?
The InChIKey is DLWVINILGBVQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4OS/c1-5-4-6(12-11-5)7(13)10-8-9-2-3-14-8/h2-4H,1H3,(H,11,12)(H,9,10,13).
What are the key properties of 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide?
5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide has a molecular weight of 208.25 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(1,3-thiazol-2-yl)-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 24744458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).